C16H22BrIN6O2 — CID 111700448
1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111700448) has the molecular formula C16H22BrIN6O2 and a molecular weight of 537.20 g/mol. Its IUPAC name is 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111700448 |
| Molecular Formula | C16H22BrIN6O2 |
| Molecular Weight | 537.20 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1cc(Br)c2c(c1)OCO2.I |
| InChI | InChI=1S/C16H21BrN6O2.HI/c1-3-14-22-21-9-23(14)5-4-19-16(18-2)20-8-11-6-12(17)15-13(7-11)24-10-25-15;/h6-7,9H,3-5,8,10H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | GUMYIYOTWLFWFM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|