C18H18BrN3O4 — CID 111846323
1-(1,3-benzodioxol-5-ylmethyl)-3-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methylguanidine (PubChem CID 111846323) has the molecular formula C18H18BrN3O4 and a molecular weight of 420.26 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111846323 |
| Molecular Formula | C18H18BrN3O4 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc2c(c1)OCO2)NCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C18H18BrN3O4/c1-20-18(21-7-11-2-3-14-15(5-11)24-9-23-14)22-8-12-4-13(19)17-16(6-12)25-10-26-17/h2-6H,7-10H2,1H3,(H2,20,21,22) |
| InChIKey | OVBRLWYKVMCBMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|