C15H20BrN3O2 — CID 119151309
1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(cyclobutylmethyl)-2-methylguanidine (PubChem CID 119151309) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(cyclobutylmethyl)-2-methylguanidine.
| Compound Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(cyclobutylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 119151309 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(cyclobutylmethyl)-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(Br)c2c(c1)OCO2)NCC1CCC1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-17-15(18-7-10-3-2-4-10)19-8-11-5-12(16)14-13(6-11)20-9-21-14/h5-6,10H,2-4,7-9H2,1H3,(H2,17,18,19) |
| InChIKey | ABFLRGJOCITTTF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|