C15H23BrIN3O3 — CID 111224124
1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(3-ethoxypropyl)-2-methylguanidine;hydroiodide (PubChem CID 111224124) has the molecular formula C15H23BrIN3O3 and a molecular weight of 500.18 g/mol. Its IUPAC name is 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(3-ethoxypropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(3-ethoxypropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111224124 |
| Molecular Formula | C15H23BrIN3O3 |
| Molecular Weight | 500.18 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-(3-ethoxypropyl)-2-methylguanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\C)NCc1cc(Br)c2c(c1)OCO2.I |
| InChI | InChI=1S/C15H22BrN3O3.HI/c1-3-20-6-4-5-18-15(17-2)19-9-11-7-12(16)14-13(8-11)21-10-22-14;/h7-8H,3-6,9-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | XCFDSTIFTJYIAM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|