C13H15BrIN3O2 — CID 119149243
1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 119149243) has the molecular formula C13H15BrIN3O2 and a molecular weight of 452.09 g/mol. Its IUPAC name is 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119149243 |
| Molecular Formula | C13H15BrIN3O2 |
| Molecular Weight | 452.09 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)NCc1cc(Br)c2c(c1)OCO2.I |
| InChI | InChI=1S/C13H14BrN3O2.HI/c1-3-4-16-13(15-2)17-7-9-5-10(14)12-11(6-9)18-8-19-12;/h1,5-6H,4,7-8H2,2H3,(H2,15,16,17);1H |
| InChIKey | NGTOOPCZIFIWSK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.09 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|