C20H25BrN4O3 — CID 111007133
1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine (PubChem CID 111007133) has the molecular formula C20H25BrN4O3 and a molecular weight of 449.35 g/mol. Its IUPAC name is 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111007133 |
| Molecular Formula | C20H25BrN4O3 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(Br)c2c(c1)OCO2)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C20H25BrN4O3/c1-22-20(23-11-14-9-15(21)19-18(10-14)27-13-28-19)24-12-16(17-5-4-8-26-17)25-6-2-3-7-25/h4-5,8-10,16H,2-3,6-7,11-13H2,1H3,(H2,22,23,24) |
| InChIKey | GOHUXGOEAPRUFM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|