C21H30N4O4 — CID 111007411
1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111007411) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111007411 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(OC)c(O)c(OC)c1)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C21H30N4O4/c1-22-21(23-13-15-11-18(27-2)20(26)19(12-15)28-3)24-14-16(17-7-6-10-29-17)25-8-4-5-9-25/h6-7,10-12,16,26H,4-5,8-9,13-14H2,1-3H3,(H2,22,23,24) |
| InChIKey | SUMBKKKGZVWDNN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|