C23H35IN4O4 — CID 111304516
1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111304516) has the molecular formula C23H35IN4O4 and a molecular weight of 558.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111304516 |
| Molecular Formula | C23H35IN4O4 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(O)c(OC)c1)NCC(c1ccco1)N1CCCCC1.I |
| InChI | InChI=1S/C23H34N4O4.HI/c1-4-24-23(25-15-17-13-20(29-2)22(28)21(14-17)30-3)26-16-18(19-9-8-12-31-19)27-10-6-5-7-11-27;/h8-9,12-14,18,28H,4-7,10-11,15-16H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | ILXAZOMCALOLPH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|