C24H35IN4O3 — CID 111326411
1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111326411) has the molecular formula C24H35IN4O3 and a molecular weight of 554.47 g/mol. Its IUPAC name is 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111326411 |
| Molecular Formula | C24H35IN4O3 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(O)c(OC)c1)NCC(c1ccccc1)N1CCCC1.I |
| InChI | InChI=1S/C24H34N4O3.HI/c1-4-25-24(26-16-18-14-21(30-2)23(29)22(15-18)31-3)27-17-20(28-12-8-9-13-28)19-10-6-5-7-11-19;/h5-7,10-11,14-15,20,29H,4,8-9,12-13,16-17H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | PBLMTLWTUXRMDJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|