C25H36N4O3 — CID 111201360
2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine (PubChem CID 111201360) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111201360 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCC(c1cccc(OC)c1)N1CCCC1 |
| InChI | InChI=1S/C25H36N4O3/c1-5-26-25(27-17-19-11-12-23(31-3)24(15-19)32-4)28-18-22(29-13-6-7-14-29)20-9-8-10-21(16-20)30-2/h8-12,15-16,22H,5-7,13-14,17-18H2,1-4H3,(H2,26,27,28) |
| InChIKey | JYTVTWYDILIOFP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|