C23H34N4O3 — CID 111200476
2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine (PubChem CID 111200476) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111200476 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C23H34N4O3/c1-4-24-23(25-16-18-10-11-21(28-2)22(15-18)29-3)26-17-19(20-9-8-14-30-20)27-12-6-5-7-13-27/h8-11,14-15,19H,4-7,12-13,16-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | XRXKOFZYIJJFKH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|