C24H36IN5O3 — CID 111303970
N-[5-[[[ethylamino-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide (PubChem CID 111303970) has the molecular formula C24H36IN5O3 and a molecular weight of 569.49 g/mol. Its IUPAC name is N-[5-[[[ethylamino-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide.
| Compound Name | N-[5-[[[ethylamino-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111303970 |
| Molecular Formula | C24H36IN5O3 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | N-[5-[[[ethylamino-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(NC(C)=O)c1)NCC(c1ccco1)N1CCCCC1.I |
| InChI | InChI=1S/C24H35N5O3.HI/c1-4-25-24(26-16-19-10-11-22(31-3)20(15-19)28-18(2)30)27-17-21(23-9-8-14-32-23)29-12-6-5-7-13-29;/h8-11,14-15,21H,4-7,12-13,16-17H2,1-3H3,(H,28,30)(H2,25,26,27);1H |
| InChIKey | DOTTXWORSKYODK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|