C24H34N4O4 — CID 111304695
methyl 5-[[[ethylamino-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methylidene]amino]methyl]-2-methoxybenzoate (PubChem CID 111304695) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methylidene]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[ethylamino-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methylidene]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 111304695 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | methyl 5-[[[ethylamino-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methylidene]amino]methyl]-2-methoxybenzoate |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C24H34N4O4/c1-4-25-24(26-16-18-10-11-21(30-2)19(15-18)23(29)31-3)27-17-20(22-9-8-14-32-22)28-12-6-5-7-13-28/h8-11,14-15,20H,4-7,12-13,16-17H2,1-3H3,(H2,25,26,27) |
| InChIKey | YZIGJBSKUVHRNV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|