C22H33N5O — CID 111967579
1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-[(1-methylpyrrol-3-yl)methyl]guanidine (PubChem CID 111967579) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-[(1-methylpyrrol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-[(1-methylpyrrol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111967579 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-[(1-methylpyrrol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccn(C)c1)NCC(c1cccc(OC)c1)N1CCCC1 |
| InChI | InChI=1S/C22H33N5O/c1-4-23-22(24-15-18-10-13-26(2)17-18)25-16-21(27-11-5-6-12-27)19-8-7-9-20(14-19)28-3/h7-10,13-14,17,21H,4-6,11-12,15-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | ROTBGQJBDSDRJS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|