C21H31N5OS — CID 111346723
1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine (PubChem CID 111346723) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111346723 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-ethyl-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cnc(C)s1)NCC(c1cccc(OC)c1)N1CCCC1 |
| InChI | InChI=1S/C21H31N5OS/c1-4-22-21(24-14-19-13-23-16(2)28-19)25-15-20(26-10-5-6-11-26)17-8-7-9-18(12-17)27-3/h7-9,12-13,20H,4-6,10-11,14-15H2,1-3H3,(H2,22,24,25) |
| InChIKey | CJZDOFWTIYXXMC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|