C23H36IN5OS — CID 111516552
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide (PubChem CID 111516552) has the molecular formula C23H36IN5OS and a molecular weight of 557.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111516552 |
| Molecular Formula | C23H36IN5OS |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccc(OC)c1)N1CCCC1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C23H35N5OS.HI/c1-4-20-16-26-22(30-20)11-12-25-23(24-5-2)27-17-21(28-13-6-7-14-28)18-9-8-10-19(15-18)29-3;/h8-10,15-16,21H,4-7,11-14,17H2,1-3H3,(H2,24,25,27);1H |
| InChIKey | LRAPJCOAOOFILN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|