C21H33N5OS — CID 111514912
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine (PubChem CID 111514912) has the molecular formula C21H33N5OS and a molecular weight of 403.60 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111514912 |
| Molecular Formula | C21H33N5OS |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccco1)N1CCCCC1)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C21H33N5OS/c1-3-17-15-24-20(28-17)10-11-23-21(22-4-2)25-16-18(19-9-8-14-27-19)26-12-6-5-7-13-26/h8-9,14-15,18H,3-7,10-13,16H2,1-2H3,(H2,22,23,25) |
| InChIKey | WPQBSKRWEXGQTQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|