C19H20BrN3O4 — CID 111380175
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methylguanidine (PubChem CID 111380175) has the molecular formula C19H20BrN3O4 and a molecular weight of 434.29 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111380175 |
| Molecular Formula | C19H20BrN3O4 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccc2c(c1)OCO2)NCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C19H20BrN3O4/c1-21-19(22-5-4-12-2-3-15-16(7-12)25-10-24-15)23-9-13-6-14(20)18-17(8-13)26-11-27-18/h2-3,6-8H,4-5,9-11H2,1H3,(H2,21,22,23) |
| InChIKey | HIRXWVKLLACVES-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|