C16H18BrN3O2S — CID 111379338
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(5-bromothiophen-2-yl)methyl]-2-methylguanidine (PubChem CID 111379338) has the molecular formula C16H18BrN3O2S and a molecular weight of 396.31 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(5-bromothiophen-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(5-bromothiophen-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111379338 |
| Molecular Formula | C16H18BrN3O2S |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(5-bromothiophen-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCO2)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C16H18BrN3O2S/c1-18-16(20-9-12-3-5-15(17)23-12)19-7-6-11-2-4-13-14(8-11)22-10-21-13/h2-5,8H,6-7,9-10H2,1H3,(H2,18,19,20) |
| InChIKey | OLUMIEYCYSUVHI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|