C15H20BrN3O2 — CID 119151807
1-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-(2-methylcyclopropyl)guanidine (PubChem CID 119151807) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 1-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-(2-methylcyclopropyl)guanidine.
| Compound Name | 1-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-(2-methylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 119151807 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-(2-methylcyclopropyl)guanidine |
| SMILES | C/N=C(\NCc1cc(Br)c2c(c1)OCCO2)NC1CC1C |
| InChI | InChI=1S/C15H20BrN3O2/c1-9-5-12(9)19-15(17-2)18-8-10-6-11(16)14-13(7-10)20-3-4-21-14/h6-7,9,12H,3-5,8H2,1-2H3,(H2,17,18,19) |
| InChIKey | TUVDFGSPZRZYKO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|