C17H24BrN3O3 — CID 119143412
N-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 119143412) has the molecular formula C17H24BrN3O3 and a molecular weight of 398.30 g/mol. Its IUPAC name is N-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119143412 |
| Molecular Formula | C17H24BrN3O3 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cc(Br)c2c(c1)OCCO2)N1CCC(COC)C1 |
| InChI | InChI=1S/C17H24BrN3O3/c1-19-17(21-4-3-12(10-21)11-22-2)20-9-13-7-14(18)16-15(8-13)23-5-6-24-16/h7-8,12H,3-6,9-11H2,1-2H3,(H,19,20) |
| InChIKey | PQOKAPXOTHCNSV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|