C19H30BrN3O4 — CID 111747248
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111747248) has the molecular formula C19H30BrN3O4 and a molecular weight of 444.37 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747248 |
| Molecular Formula | C19H30BrN3O4 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cc(Br)c(OC)c(OC)c1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C19H30BrN3O4/c1-21-19(23-6-5-14(12-23)13-27-8-7-24-2)22-11-15-9-16(20)18(26-4)17(10-15)25-3/h9-10,14H,5-8,11-13H2,1-4H3,(H,21,22) |
| InChIKey | NAMIDZDXDSDIGA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|