C17H28N4O4S — CID 111746455
3-(2-methoxyethoxymethyl)-N'-methyl-N-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111746455) has the molecular formula C17H28N4O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111746455 |
| Molecular Formula | C17H28N4O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(S(N)(=O)=O)cc1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C17H28N4O4S/c1-19-17(21-8-7-15(12-21)13-25-10-9-24-2)20-11-14-3-5-16(6-4-14)26(18,22)23/h3-6,15H,7-13H2,1-2H3,(H,19,20)(H2,18,22,23) |
| InChIKey | IWZKDJXSCIAPFW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|