C21H37IN4O4S — CID 111746530
3-(2-methoxyethoxymethyl)-N'-methyl-N-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111746530) has the molecular formula C21H37IN4O4S and a molecular weight of 568.52 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111746530 |
| Molecular Formula | C21H37IN4O4S |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N(C)C(C)C)cc1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C21H36N4O4S.HI/c1-17(2)24(4)30(26,27)20-8-6-18(7-9-20)14-23-21(22-3)25-11-10-19(15-25)16-29-13-12-28-5;/h6-9,17,19H,10-16H2,1-5H3,(H,22,23);1H |
| InChIKey | BWLYAFHEFWGOJV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|