C20H32N4O4S — CID 111254629
methyl 1-[N'-methyl-N-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254629) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is methyl 1-[N'-methyl-N-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-methyl-N-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254629 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | methyl 1-[N'-methyl-N-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N(C)C(C)C)cc1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H32N4O4S/c1-15(2)23(4)29(26,27)18-8-6-16(7-9-18)14-22-20(21-3)24-12-10-17(11-13-24)19(25)28-5/h6-9,15,17H,10-14H2,1-5H3,(H,21,22) |
| InChIKey | XDWCTTGJSUZURR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|