C18H28FIN4O2 — CID 111255070
methyl 1-[N-[[4-(dimethylamino)-3-fluorophenyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111255070) has the molecular formula C18H28FIN4O2 and a molecular weight of 478.35 g/mol. Its IUPAC name is methyl 1-[N-[[4-(dimethylamino)-3-fluorophenyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-[[4-(dimethylamino)-3-fluorophenyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111255070 |
| Molecular Formula | C18H28FIN4O2 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | methyl 1-[N-[[4-(dimethylamino)-3-fluorophenyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N(C)C)c(F)c1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C18H27FN4O2.HI/c1-20-18(23-9-7-14(8-10-23)17(24)25-4)21-12-13-5-6-16(22(2)3)15(19)11-13;/h5-6,11,14H,7-10,12H2,1-4H3,(H,20,21);1H |
| InChIKey | KKZWLQAPSWBBQZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|