C20H29FN4O3 — CID 111253707
methyl 1-[N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111253707) has the molecular formula C20H29FN4O3 and a molecular weight of 392.48 g/mol. Its IUPAC name is methyl 1-[N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111253707 |
| Molecular Formula | C20H29FN4O3 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | methyl 1-[N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(/NCc1ccc(N2CCOCC2)c(F)c1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H29FN4O3/c1-22-20(25-7-5-16(6-8-25)19(26)27-2)23-14-15-3-4-18(17(21)13-15)24-9-11-28-12-10-24/h3-4,13,16H,5-12,14H2,1-2H3,(H,22,23) |
| InChIKey | FYPMCYHDMWCFFT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|