C22H33FN4O — CID 111745062
N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 111745062) has the molecular formula C22H33FN4O and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 111745062 |
| Molecular Formula | C22H33FN4O |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(N2CCOCC2)c(F)c1)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C22H33FN4O/c1-24-21(27-10-9-22(17-27)7-3-2-4-8-22)25-16-18-5-6-20(19(23)15-18)26-11-13-28-14-12-26/h5-6,15H,2-4,7-14,16-17H2,1H3,(H,24,25) |
| InChIKey | SOFWCCDGSQWCHU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|