C20H33IN4 — CID 111733218
N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide (PubChem CID 111733218) has the molecular formula C20H33IN4 and a molecular weight of 456.42 g/mol. Its IUPAC name is N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide.
| Compound Name | N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111733218 |
| Molecular Formula | C20H33IN4 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[[4-[(dimethylamino)methyl]phenyl]methyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(CN(C)C)cc1)N1CCC2(CCCC2)C1.I |
| InChI | InChI=1S/C20H32N4.HI/c1-21-19(24-13-12-20(16-24)10-4-5-11-20)22-14-17-6-8-18(9-7-17)15-23(2)3;/h6-9H,4-5,10-16H2,1-3H3,(H,21,22);1H |
| InChIKey | VJAAGUWAUQZBKK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|