C17H27IN4O2S — CID 111732826
N'-methyl-N-[(4-sulfamoylphenyl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide (PubChem CID 111732826) has the molecular formula C17H27IN4O2S and a molecular weight of 478.40 g/mol. Its IUPAC name is N'-methyl-N-[(4-sulfamoylphenyl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(4-sulfamoylphenyl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111732826 |
| Molecular Formula | C17H27IN4O2S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N'-methyl-N-[(4-sulfamoylphenyl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)cc1)N1CCC2(CCCC2)C1.I |
| InChI | InChI=1S/C17H26N4O2S.HI/c1-19-16(21-11-10-17(13-21)8-2-3-9-17)20-12-14-4-6-15(7-5-14)24(18,22)23;/h4-7H,2-3,8-13H2,1H3,(H,19,20)(H2,18,22,23);1H |
| InChIKey | MQMCIUMIBDNFOK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|