C19H31IN4O2S — CID 111744947
N'-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide (PubChem CID 111744947) has the molecular formula C19H31IN4O2S and a molecular weight of 506.45 g/mol. Its IUPAC name is N'-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111744947 |
| Molecular Formula | C19H31IN4O2S |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N'-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(S(N)(=O)=O)cc1)N1CCC2(CCCCC2)C1.I |
| InChI | InChI=1S/C19H30N4O2S.HI/c1-21-18(23-14-12-19(15-23)10-3-2-4-11-19)22-13-9-16-5-7-17(8-6-16)26(20,24)25;/h5-8H,2-4,9-15H2,1H3,(H,21,22)(H2,20,24,25);1H |
| InChIKey | QIOQRKLCMWDPNY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|