C19H30IN3O2S — CID 111732656
N-[3-(benzenesulfonyl)propyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide (PubChem CID 111732656) has the molecular formula C19H30IN3O2S and a molecular weight of 491.44 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)propyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide.
| Compound Name | N-[3-(benzenesulfonyl)propyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111732656 |
| Molecular Formula | C19H30IN3O2S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[3-(benzenesulfonyl)propyl]-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCS(=O)(=O)c1ccccc1)N1CCC2(CCCC2)C1.I |
| InChI | InChI=1S/C19H29N3O2S.HI/c1-20-18(22-14-12-19(16-22)10-5-6-11-19)21-13-7-15-25(23,24)17-8-3-2-4-9-17;/h2-4,8-9H,5-7,10-16H2,1H3,(H,20,21);1H |
| InChIKey | VVOQMBGRPDZBKD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|