C21H34IN3O2S — CID 111745077
N-(3-benzylsulfonylpropyl)-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide (PubChem CID 111745077) has the molecular formula C21H34IN3O2S and a molecular weight of 519.49 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide.
| Compound Name | N-(3-benzylsulfonylpropyl)-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111745077 |
| Molecular Formula | C21H34IN3O2S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCS(=O)(=O)Cc1ccccc1)N1CCC2(CCCCC2)C1.I |
| InChI | InChI=1S/C21H33N3O2S.HI/c1-22-20(24-15-13-21(18-24)11-6-3-7-12-21)23-14-8-16-27(25,26)17-19-9-4-2-5-10-19;/h2,4-5,9-10H,3,6-8,11-18H2,1H3,(H,22,23);1H |
| InChIKey | PXPPKJDMBDKMCG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|