C19H31IN4 — CID 109406181
N'-methyl-N-[2-(3-methyl-4-pyridinyl)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide (PubChem CID 109406181) has the molecular formula C19H31IN4 and a molecular weight of 442.39 g/mol. Its IUPAC name is N'-methyl-N-[2-(3-methyl-4-pyridinyl)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[2-(3-methyl-4-pyridinyl)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109406181 |
| Molecular Formula | C19H31IN4 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N'-methyl-N-[2-(3-methyl-4-pyridinyl)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccncc1C)N1CCC2(CCCCC2)C1.I |
| InChI | InChI=1S/C19H30N4.HI/c1-16-14-21-11-6-17(16)7-12-22-18(20-2)23-13-10-19(15-23)8-4-3-5-9-19;/h6,11,14H,3-5,7-10,12-13,15H2,1-2H3,(H,20,22);1H |
| InChIKey | VKHNCWNIORJEHR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|