C17H28N6 — CID 119145392
N'-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 119145392) has the molecular formula C17H28N6 and a molecular weight of 316.45 g/mol. Its IUPAC name is N'-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N'-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 119145392 |
| Molecular Formula | C17H28N6 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | N'-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | C/N=C(\NCCNc1cnccn1)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C17H28N6/c1-18-16(22-11-10-21-15-13-19-8-9-20-15)23-12-7-17(14-23)5-3-2-4-6-17/h8-9,13H,2-7,10-12,14H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | LPTVGDAIPKQVGI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|