C18H30N6 — CID 119145308
N-ethyl-N'-[2-(pyrazin-2-ylamino)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 119145308) has the molecular formula C18H30N6 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-ethyl-N'-[2-(pyrazin-2-ylamino)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(pyrazin-2-ylamino)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 119145308 |
| Molecular Formula | C18H30N6 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | N-ethyl-N'-[2-(pyrazin-2-ylamino)ethyl]-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | CCN/C(=N\CCNc1cnccn1)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C18H30N6/c1-2-20-17(23-12-11-22-16-14-19-9-10-21-16)24-13-8-18(15-24)6-4-3-5-7-18/h9-10,14H,2-8,11-13,15H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | PBLVNQBQLNBSCL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|