C17H27IN6O — CID 119144359
N-ethyl-N'-[2-(pyrazin-2-ylamino)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119144359) has the molecular formula C17H27IN6O and a molecular weight of 458.35 g/mol. Its IUPAC name is N-ethyl-N'-[2-(pyrazin-2-ylamino)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(pyrazin-2-ylamino)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119144359 |
| Molecular Formula | C17H27IN6O |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-ethyl-N'-[2-(pyrazin-2-ylamino)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCNc1cnccn1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C17H26N6O.HI/c1-2-19-17(22-8-7-21-16-9-18-5-6-20-16)23-10-12-13(11-23)15-4-3-14(12)24-15;/h5-6,9,12-15H,2-4,7-8,10-11H2,1H3,(H,19,22)(H,20,21);1H |
| InChIKey | ADBZNSOJMOGVIL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|