C17H29N7 — CID 119142987
N'-methyl-3-piperidin-1-yl-N-[2-(pyrazin-2-ylamino)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 119142987) has the molecular formula C17H29N7 and a molecular weight of 331.47 g/mol. Its IUPAC name is N'-methyl-3-piperidin-1-yl-N-[2-(pyrazin-2-ylamino)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-piperidin-1-yl-N-[2-(pyrazin-2-ylamino)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119142987 |
| Molecular Formula | C17H29N7 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | N'-methyl-3-piperidin-1-yl-N-[2-(pyrazin-2-ylamino)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCNc1cnccn1)N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C17H29N7/c1-18-17(22-9-8-21-16-13-19-6-7-20-16)24-12-5-15(14-24)23-10-3-2-4-11-23/h6-7,13,15H,2-5,8-12,14H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | QGOPKNUULIXLSJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|