C18H33N7 — CID 119159796
N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-N'-methyl-3-piperidin-1-ylpyrrolidine-1-carboximidamide (PubChem CID 119159796) has the molecular formula C18H33N7 and a molecular weight of 347.51 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-N'-methyl-3-piperidin-1-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-N'-methyl-3-piperidin-1-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119159796 |
| Molecular Formula | C18H33N7 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-N'-methyl-3-piperidin-1-ylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cnc(N(C)C)n1C)N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C18H33N7/c1-19-17(20-12-16-13-21-18(22(2)3)23(16)4)25-11-8-15(14-25)24-9-6-5-7-10-24/h13,15H,5-12,14H2,1-4H3,(H,19,20) |
| InChIKey | UUGVXQOOEOOJJF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|