C19H28FN7 — CID 119159491
N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 119159491) has the molecular formula C19H28FN7 and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119159491 |
| Molecular Formula | C19H28FN7 |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cnc(N(C)C)n1C)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H28FN7/c1-21-18(22-13-17-14-23-19(24(2)3)25(17)4)27-11-9-26(10-12-27)16-7-5-15(20)6-8-16/h5-8,14H,9-13H2,1-4H3,(H,21,22) |
| InChIKey | JHCPAACZHFVNIP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|