C17H33IN6 — CID 119159840
N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-N'-methyl-3-(2-methylpropyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119159840) has the molecular formula C17H33IN6 and a molecular weight of 448.40 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-N'-methyl-3-(2-methylpropyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-N'-methyl-3-(2-methylpropyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119159840 |
| Molecular Formula | C17H33IN6 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-N'-methyl-3-(2-methylpropyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1cnc(N(C)C)n1C)N1CCC(CC(C)C)C1.I |
| InChI | InChI=1S/C17H32N6.HI/c1-13(2)9-14-7-8-23(12-14)16(18-3)19-10-15-11-20-17(21(4)5)22(15)6;/h11,13-14H,7-10,12H2,1-6H3,(H,18,19);1H |
| InChIKey | VICXCVLTACOHIM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|