C22H30FIN4O3 — CID 111165022
4-(4-fluorophenyl)-N'-methyl-N-[(2,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111165022) has the molecular formula C22H30FIN4O3 and a molecular weight of 544.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-methyl-N-[(2,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-methyl-N-[(2,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111165022 |
| Molecular Formula | C22H30FIN4O3 |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-methyl-N-[(2,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)cc1OC)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C22H29FN4O3.HI/c1-24-22(25-15-16-13-20(29-3)21(30-4)14-19(16)28-2)27-11-9-26(10-12-27)18-7-5-17(23)6-8-18;/h5-8,13-14H,9-12,15H2,1-4H3,(H,24,25);1H |
| InChIKey | GSNKFQSFGKJIRU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|