C20H25F2IN4O — CID 111165396
N-[(3-fluoro-4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111165396) has the molecular formula C20H25F2IN4O and a molecular weight of 502.35 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111165396 |
| Molecular Formula | C20H25F2IN4O |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OC)c(F)c1)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C20H24F2N4O.HI/c1-23-20(24-14-15-3-8-19(27-2)18(22)13-15)26-11-9-25(10-12-26)17-6-4-16(21)5-7-17;/h3-8,13H,9-12,14H2,1-2H3,(H,23,24);1H |
| InChIKey | VIYCHGKHGKSGJX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|