C17H26FIN4O3 — CID 111163596
ethyl 4-[N-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111163596) has the molecular formula C17H26FIN4O3 and a molecular weight of 480.32 g/mol. Its IUPAC name is ethyl 4-[N-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111163596 |
| Molecular Formula | C17H26FIN4O3 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | ethyl 4-[N-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCc2ccc(OC)c(F)c2)CC1.I |
| InChI | InChI=1S/C17H25FN4O3.HI/c1-4-25-17(23)22-9-7-21(8-10-22)16(19-2)20-12-13-5-6-15(24-3)14(18)11-13;/h5-6,11H,4,7-10,12H2,1-3H3,(H,19,20);1H |
| InChIKey | UTLGNBSUFQCEAF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|