C18H27BrN4O4 — CID 111164615
ethyl 4-[N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111164615) has the molecular formula C18H27BrN4O4 and a molecular weight of 443.34 g/mol. Its IUPAC name is ethyl 4-[N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111164615 |
| Molecular Formula | C18H27BrN4O4 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | ethyl 4-[N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N\C)NCc2cc(OC)c(OC)cc2Br)CC1 |
| InChI | InChI=1S/C18H27BrN4O4/c1-5-27-18(24)23-8-6-22(7-9-23)17(20-2)21-12-13-10-15(25-3)16(26-4)11-14(13)19/h10-11H,5-9,12H2,1-4H3,(H,20,21) |
| InChIKey | AOXFBYSZECTMGD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|