C14H22BrN3O2 — CID 111225525
1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-propylguanidine (PubChem CID 111225525) has the molecular formula C14H22BrN3O2 and a molecular weight of 344.25 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-propylguanidine.
| Compound Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-propylguanidine |
|---|---|
| PubChem CID | 111225525 |
| Molecular Formula | C14H22BrN3O2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-propylguanidine |
| SMILES | CCCN/C(=N\C)NCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C14H22BrN3O2/c1-5-6-17-14(16-2)18-9-10-7-12(19-3)13(20-4)8-11(10)15/h7-8H,5-6,9H2,1-4H3,(H2,16,17,18) |
| InChIKey | KBVYWAGNSLYSGV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|