C15H26IN3O3S — CID 111345096
2-methyl-1-(2-methylsulfanylethyl)-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111345096) has the molecular formula C15H26IN3O3S and a molecular weight of 455.36 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfanylethyl)-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylsulfanylethyl)-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111345096 |
| Molecular Formula | C15H26IN3O3S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 2-methyl-1-(2-methylsulfanylethyl)-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)NCc1cc(OC)c(OC)cc1OC.I |
| InChI | InChI=1S/C15H25N3O3S.HI/c1-16-15(17-6-7-22-5)18-10-11-8-13(20-3)14(21-4)9-12(11)19-2;/h8-9H,6-7,10H2,1-5H3,(H2,16,17,18);1H |
| InChIKey | DQAGINSVCOYZAF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|