C22H32IN3O5 — CID 111213214
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111213214) has the molecular formula C22H32IN3O5 and a molecular weight of 545.42 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111213214 |
| Molecular Formula | C22H32IN3O5 |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(OC)c(OC)c1)NCc1cc(OC)c(OC)cc1OC.I |
| InChI | InChI=1S/C22H31N3O5.HI/c1-23-22(24-10-9-15-7-8-17(26-2)19(11-15)28-4)25-14-16-12-20(29-5)21(30-6)13-18(16)27-3;/h7-8,11-13H,9-10,14H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | YLRNCHLRLMMAGA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|