C19H25FIN3O3 — CID 111793801
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111793801) has the molecular formula C19H25FIN3O3 and a molecular weight of 489.33 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111793801 |
| Molecular Formula | C19H25FIN3O3 |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCc1ccc(O)c(F)c1.I |
| InChI | InChI=1S/C19H24FN3O3.HI/c1-21-19(23-12-14-4-6-16(24)15(20)10-14)22-9-8-13-5-7-17(25-2)18(11-13)26-3;/h4-7,10-11,24H,8-9,12H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | MGHQOSPJTCXESB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|