C18H31N3O5 — CID 111368181
1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111368181) has the molecular formula C18H31N3O5 and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111368181 |
| Molecular Formula | C18H31N3O5 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCOCCOC)NCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C18H31N3O5/c1-19-18(20-7-6-8-26-10-9-22-2)21-13-14-11-16(24-4)17(25-5)12-15(14)23-3/h11-12H,6-10,13H2,1-5H3,(H2,19,20,21) |
| InChIKey | HRZITEUTGDKYOI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|